C18H20N6O2S — CID 112860886
4-[2-[[6-(pyridin-4-ylmethylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide (PubChem CID 112860886) has the molecular formula C18H20N6O2S and a molecular weight of 384.47 g/mol. Its IUPAC name is 4-[2-[[6-(pyridin-4-ylmethylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[6-(pyridin-4-ylmethylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112860886 |
| Molecular Formula | C18H20N6O2S |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 4-[2-[[6-(pyridin-4-ylmethylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNc2cc(NCc3ccncc3)ncn2)cc1 |
| InChI | InChI=1S/C18H20N6O2S/c19-27(25,26)16-3-1-14(2-4-16)7-10-21-17-11-18(24-13-23-17)22-12-15-5-8-20-9-6-15/h1-6,8-9,11,13H,7,10,12H2,(H2,19,25,26)(H2,21,22,23,24) |
| InChIKey | RSAUYDLTHGOPJV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |