C20H23N5O2S — CID 112862444
4-[2-[[6-(2,3-dimethylanilino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide (PubChem CID 112862444) has the molecular formula C20H23N5O2S and a molecular weight of 397.50 g/mol. Its IUPAC name is 4-[2-[[6-(2,3-dimethylanilino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[6-(2,3-dimethylanilino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112862444 |
| Molecular Formula | C20H23N5O2S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 4-[2-[[6-(2,3-dimethylanilino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
| SMILES | Cc1cccc(Nc2cc(NCCc3ccc(S(N)(=O)=O)cc3)ncn2)c1C |
| InChI | InChI=1S/C20H23N5O2S/c1-14-4-3-5-18(15(14)2)25-20-12-19(23-13-24-20)22-11-10-16-6-8-17(9-7-16)28(21,26)27/h3-9,12-13H,10-11H2,1-2H3,(H2,21,26,27)(H2,22,23,24,25) |
| InChIKey | ZSVKRMGSXRTMRI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |