C17H24N4 — CID 112864108
4-N-(2,3-dimethylphenyl)-6-N-pentylpyrimidine-4,6-diamine (PubChem CID 112864108) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 4-N-(2,3-dimethylphenyl)-6-N-pentylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(2,3-dimethylphenyl)-6-N-pentylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112864108 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 4-N-(2,3-dimethylphenyl)-6-N-pentylpyrimidine-4,6-diamine |
| SMILES | CCCCCNc1cc(Nc2cccc(C)c2C)ncn1 |
| InChI | InChI=1S/C17H24N4/c1-4-5-6-10-18-16-11-17(20-12-19-16)21-15-9-7-8-13(2)14(15)3/h7-9,11-12H,4-6,10H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | PNASPAKVIZFGOY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|