C17H23ClN4O — CID 112864177
4-N-(4-chloro-2-methoxy-5-methylphenyl)-6-N-pentylpyrimidine-4,6-diamine (PubChem CID 112864177) has the molecular formula C17H23ClN4O and a molecular weight of 334.85 g/mol. Its IUPAC name is 4-N-(4-chloro-2-methoxy-5-methylphenyl)-6-N-pentylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(4-chloro-2-methoxy-5-methylphenyl)-6-N-pentylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112864177 |
| Molecular Formula | C17H23ClN4O |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 4-N-(4-chloro-2-methoxy-5-methylphenyl)-6-N-pentylpyrimidine-4,6-diamine |
| SMILES | CCCCCNc1cc(Nc2cc(C)c(Cl)cc2OC)ncn1 |
| InChI | InChI=1S/C17H23ClN4O/c1-4-5-6-7-19-16-10-17(21-11-20-16)22-14-8-12(2)13(18)9-15(14)23-3/h8-11H,4-7H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | MGEBDZVRZHVNHN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|