C14H18N4 — CID 80755281
4-N-(2-methylphenyl)-6-N-propylpyrimidine-4,6-diamine (PubChem CID 80755281) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is 4-N-(2-methylphenyl)-6-N-propylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-methylphenyl)-6-N-propylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80755281 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 4-N-(2-methylphenyl)-6-N-propylpyrimidine-4,6-diamine |
| SMILES | CCCNc1cc(Nc2ccccc2C)ncn1 |
| InChI | InChI=1S/C14H18N4/c1-3-8-15-13-9-14(17-10-16-13)18-12-7-5-4-6-11(12)2/h4-7,9-10H,3,8H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | DYYGGSNKEDYZOQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |