C20H22N4 — CID 112879241
4-N-(2-methylphenyl)-2-phenyl-6-N-propylpyrimidine-4,6-diamine (PubChem CID 112879241) has the molecular formula C20H22N4 and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-N-(2-methylphenyl)-2-phenyl-6-N-propylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-methylphenyl)-2-phenyl-6-N-propylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112879241 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 4-N-(2-methylphenyl)-2-phenyl-6-N-propylpyrimidine-4,6-diamine |
| SMILES | CCCNc1cc(Nc2ccccc2C)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H22N4/c1-3-13-21-18-14-19(22-17-12-8-7-9-15(17)2)24-20(23-18)16-10-5-4-6-11-16/h4-12,14H,3,13H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | OSRPRKCNHQOWRI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |