C23H27N5 — CID 112879269
2-phenyl-6-N-propyl-4-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-4,6-diamine (PubChem CID 112879269) has the molecular formula C23H27N5 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-phenyl-6-N-propyl-4-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-4,6-diamine.
| Compound Name | 2-phenyl-6-N-propyl-4-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112879269 |
| Molecular Formula | C23H27N5 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 2-phenyl-6-N-propyl-4-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-4,6-diamine |
| SMILES | CCCNc1cc(Nc2ccc(N3CCCC3)cc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H27N5/c1-2-14-24-21-17-22(27-23(26-21)18-8-4-3-5-9-18)25-19-10-12-20(13-11-19)28-15-6-7-16-28/h3-5,8-13,17H,2,6-7,14-16H2,1H3,(H2,24,25,26,27) |
| InChIKey | CRKFOBZSCQLTAX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|