C17H24N6O3S — CID 109344268
N-[2-(dimethylamino)ethyl]-6-[2-(4-sulfamoylphenyl)ethylamino]pyrimidine-4-carboxamide (PubChem CID 109344268) has the molecular formula C17H24N6O3S and a molecular weight of 392.49 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-6-[2-(4-sulfamoylphenyl)ethylamino]pyrimidine-4-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-6-[2-(4-sulfamoylphenyl)ethylamino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109344268 |
| Molecular Formula | C17H24N6O3S |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-6-[2-(4-sulfamoylphenyl)ethylamino]pyrimidine-4-carboxamide |
| SMILES | CN(C)CCNC(=O)c1cc(NCCc2ccc(S(N)(=O)=O)cc2)ncn1 |
| InChI | InChI=1S/C17H24N6O3S/c1-23(2)10-9-20-17(24)15-11-16(22-12-21-15)19-8-7-13-3-5-14(6-4-13)27(18,25)26/h3-6,11-12H,7-10H2,1-2H3,(H,20,24)(H2,18,25,26)(H,19,21,22) |
| InChIKey | WXCIKWQRKHJMAU-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |