C19H19N5O3S — CID 109352293
6-anilino-N-[2-(4-sulfamoylphenyl)ethyl]pyrimidine-4-carboxamide (PubChem CID 109352293) has the molecular formula C19H19N5O3S and a molecular weight of 397.46 g/mol. Its IUPAC name is 6-anilino-N-[2-(4-sulfamoylphenyl)ethyl]pyrimidine-4-carboxamide.
| Compound Name | 6-anilino-N-[2-(4-sulfamoylphenyl)ethyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109352293 |
| Molecular Formula | C19H19N5O3S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 6-anilino-N-[2-(4-sulfamoylphenyl)ethyl]pyrimidine-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)c2cc(Nc3ccccc3)ncn2)cc1 |
| InChI | InChI=1S/C19H19N5O3S/c20-28(26,27)16-8-6-14(7-9-16)10-11-21-19(25)17-12-18(23-13-22-17)24-15-4-2-1-3-5-15/h1-9,12-13H,10-11H2,(H,21,25)(H2,20,26,27)(H,22,23,24) |
| InChIKey | XRZGDXGIKKLXFI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |