C20H23N5O2S — CID 112861041
4-[2-[[6-(2-phenylethylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide (PubChem CID 112861041) has the molecular formula C20H23N5O2S and a molecular weight of 397.50 g/mol. Its IUPAC name is 4-[2-[[6-(2-phenylethylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[6-(2-phenylethylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112861041 |
| Molecular Formula | C20H23N5O2S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 4-[2-[[6-(2-phenylethylamino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNc2cc(NCCc3ccccc3)ncn2)cc1 |
| InChI | InChI=1S/C20H23N5O2S/c21-28(26,27)18-8-6-17(7-9-18)11-13-23-20-14-19(24-15-25-20)22-12-10-16-4-2-1-3-5-16/h1-9,14-15H,10-13H2,(H2,21,26,27)(H2,22,23,24,25) |
| InChIKey | TZBXFPNPOVOJJB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |