C18H25N5O3S — CID 109352290
6-(3-methylbutylamino)-N-[2-(4-sulfamoylphenyl)ethyl]pyrimidine-4-carboxamide (PubChem CID 109352290) has the molecular formula C18H25N5O3S and a molecular weight of 391.50 g/mol. Its IUPAC name is 6-(3-methylbutylamino)-N-[2-(4-sulfamoylphenyl)ethyl]pyrimidine-4-carboxamide.
| Compound Name | 6-(3-methylbutylamino)-N-[2-(4-sulfamoylphenyl)ethyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109352290 |
| Molecular Formula | C18H25N5O3S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 6-(3-methylbutylamino)-N-[2-(4-sulfamoylphenyl)ethyl]pyrimidine-4-carboxamide |
| SMILES | CC(C)CCNc1cc(C(=O)NCCc2ccc(S(N)(=O)=O)cc2)ncn1 |
| InChI | InChI=1S/C18H25N5O3S/c1-13(2)7-9-20-17-11-16(22-12-23-17)18(24)21-10-8-14-3-5-15(6-4-14)27(19,25)26/h3-6,11-13H,7-10H2,1-2H3,(H,21,24)(H2,19,25,26)(H,20,22,23) |
| InChIKey | CCPYJQHAGPIATN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |