C21H25N5 — CID 112861804
4-N-methyl-6-N-(3-phenylpropyl)-4-N-(2-pyridin-4-ylethyl)pyrimidine-4,6-diamine (PubChem CID 112861804) has the molecular formula C21H25N5 and a molecular weight of 347.47 g/mol. Its IUPAC name is 4-N-methyl-6-N-(3-phenylpropyl)-4-N-(2-pyridin-4-ylethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-methyl-6-N-(3-phenylpropyl)-4-N-(2-pyridin-4-ylethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112861804 |
| Molecular Formula | C21H25N5 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 4-N-methyl-6-N-(3-phenylpropyl)-4-N-(2-pyridin-4-ylethyl)pyrimidine-4,6-diamine |
| SMILES | CN(CCc1ccncc1)c1cc(NCCCc2ccccc2)ncn1 |
| InChI | InChI=1S/C21H25N5/c1-26(15-11-19-9-13-22-14-10-19)21-16-20(24-17-25-21)23-12-5-8-18-6-3-2-4-7-18/h2-4,6-7,9-10,13-14,16-17H,5,8,11-12,15H2,1H3,(H,23,24,25) |
| InChIKey | ZHUGKRYCTASMKB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|