C23H28N4 — CID 112873142
4-N-benzyl-4-N-ethyl-2-methyl-6-N-(3-phenylpropyl)pyrimidine-4,6-diamine (PubChem CID 112873142) has the molecular formula C23H28N4 and a molecular weight of 360.51 g/mol. Its IUPAC name is 4-N-benzyl-4-N-ethyl-2-methyl-6-N-(3-phenylpropyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-benzyl-4-N-ethyl-2-methyl-6-N-(3-phenylpropyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112873142 |
| Molecular Formula | C23H28N4 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 4-N-benzyl-4-N-ethyl-2-methyl-6-N-(3-phenylpropyl)pyrimidine-4,6-diamine |
| SMILES | CCN(Cc1ccccc1)c1cc(NCCCc2ccccc2)nc(C)n1 |
| InChI | InChI=1S/C23H28N4/c1-3-27(18-21-13-8-5-9-14-21)23-17-22(25-19(2)26-23)24-16-10-15-20-11-6-4-7-12-20/h4-9,11-14,17H,3,10,15-16,18H2,1-2H3,(H,24,25,26) |
| InChIKey | JFZYCIGYITYLQH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|