C18H26N4 — CID 112871547
6-N-benzyl-2-methyl-4-N,4-N-dipropylpyrimidine-4,6-diamine (PubChem CID 112871547) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is 6-N-benzyl-2-methyl-4-N,4-N-dipropylpyrimidine-4,6-diamine.
| Compound Name | 6-N-benzyl-2-methyl-4-N,4-N-dipropylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112871547 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 6-N-benzyl-2-methyl-4-N,4-N-dipropylpyrimidine-4,6-diamine |
| SMILES | CCCN(CCC)c1cc(NCc2ccccc2)nc(C)n1 |
| InChI | InChI=1S/C18H26N4/c1-4-11-22(12-5-2)18-13-17(20-15(3)21-18)19-14-16-9-7-6-8-10-16/h6-10,13H,4-5,11-12,14H2,1-3H3,(H,19,20,21) |
| InChIKey | BXRXRQYAUBWMBI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |