C16H23N5 — CID 112947577
5-N-benzyl-3-N,3-N-dipropyl-1,2,4-triazine-3,5-diamine (PubChem CID 112947577) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is 5-N-benzyl-3-N,3-N-dipropyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-benzyl-3-N,3-N-dipropyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112947577 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 5-N-benzyl-3-N,3-N-dipropyl-1,2,4-triazine-3,5-diamine |
| SMILES | CCCN(CCC)c1nncc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C16H23N5/c1-3-10-21(11-4-2)16-19-15(13-18-20-16)17-12-14-8-6-5-7-9-14/h5-9,13H,3-4,10-12H2,1-2H3,(H,17,19,20) |
| InChIKey | YOFTXFUKTRYYSQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |