C17H23N5O2 — CID 112951342
5-N-(1,3-benzodioxol-5-ylmethyl)-3-N,3-N-dipropyl-1,2,4-triazine-3,5-diamine (PubChem CID 112951342) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 5-N-(1,3-benzodioxol-5-ylmethyl)-3-N,3-N-dipropyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(1,3-benzodioxol-5-ylmethyl)-3-N,3-N-dipropyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112951342 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 5-N-(1,3-benzodioxol-5-ylmethyl)-3-N,3-N-dipropyl-1,2,4-triazine-3,5-diamine |
| SMILES | CCCN(CCC)c1nncc(NCc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C17H23N5O2/c1-3-7-22(8-4-2)17-20-16(11-19-21-17)18-10-13-5-6-14-15(9-13)24-12-23-14/h5-6,9,11H,3-4,7-8,10,12H2,1-2H3,(H,18,20,21) |
| InChIKey | SVMAFSZBBMGLEO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |