C19H24N4O3 — CID 109258197
N-(1,3-benzodioxol-5-ylmethyl)-2-(dipropylamino)pyrimidine-5-carboxamide (PubChem CID 109258197) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(dipropylamino)pyrimidine-5-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(dipropylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109258197 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(dipropylamino)pyrimidine-5-carboxamide |
| SMILES | CCCN(CCC)c1ncc(C(=O)NCc2ccc3c(c2)OCO3)cn1 |
| InChI | InChI=1S/C19H24N4O3/c1-3-7-23(8-4-2)19-21-11-15(12-22-19)18(24)20-10-14-5-6-16-17(9-14)26-13-25-16/h5-6,9,11-12H,3-4,7-8,10,13H2,1-2H3,(H,20,24) |
| InChIKey | UZEHOSQWVKZLLI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |