C17H20N4O4 — CID 109251873
N-(1,3-benzodioxol-5-ylmethyl)-2-(3-methoxypropylamino)pyrimidine-5-carboxamide (PubChem CID 109251873) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(3-methoxypropylamino)pyrimidine-5-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(3-methoxypropylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109251873 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(3-methoxypropylamino)pyrimidine-5-carboxamide |
| SMILES | COCCCNc1ncc(C(=O)NCc2ccc3c(c2)OCO3)cn1 |
| InChI | InChI=1S/C17H20N4O4/c1-23-6-2-5-18-17-20-9-13(10-21-17)16(22)19-8-12-3-4-14-15(7-12)25-11-24-14/h3-4,7,9-10H,2,5-6,8,11H2,1H3,(H,19,22)(H,18,20,21) |
| InChIKey | AHSZUCNBTFWYRA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|