C21H18N4O4 — CID 109258234
2-(3-acetylanilino)-N-(1,3-benzodioxol-5-ylmethyl)pyrimidine-5-carboxamide (PubChem CID 109258234) has the molecular formula C21H18N4O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is 2-(3-acetylanilino)-N-(1,3-benzodioxol-5-ylmethyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(3-acetylanilino)-N-(1,3-benzodioxol-5-ylmethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109258234 |
| Molecular Formula | C21H18N4O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2-(3-acetylanilino)-N-(1,3-benzodioxol-5-ylmethyl)pyrimidine-5-carboxamide |
| SMILES | CC(=O)c1cccc(Nc2ncc(C(=O)NCc3ccc4c(c3)OCO4)cn2)c1 |
| InChI | InChI=1S/C21H18N4O4/c1-13(26)15-3-2-4-17(8-15)25-21-23-10-16(11-24-21)20(27)22-9-14-5-6-18-19(7-14)29-12-28-18/h2-8,10-11H,9,12H2,1H3,(H,22,27)(H,23,24,25) |
| InChIKey | HGLXNCQKFDOHBO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |