C17H16N2O3S — CID 8626665
1-(3-acetylphenyl)-3-(1,3-benzodioxol-5-ylmethyl)thiourea (PubChem CID 8626665) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-(1,3-benzodioxol-5-ylmethyl)thiourea.
| Compound Name | 1-(3-acetylphenyl)-3-(1,3-benzodioxol-5-ylmethyl)thiourea |
|---|---|
| PubChem CID | 8626665 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 1-(3-acetylphenyl)-3-(1,3-benzodioxol-5-ylmethyl)thiourea |
| SMILES | CC(=O)c1cccc(NC(=S)NCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C17H16N2O3S/c1-11(20)13-3-2-4-14(8-13)19-17(23)18-9-12-5-6-15-16(7-12)22-10-21-15/h2-8H,9-10H2,1H3,(H2,18,19,23) |
| InChIKey | QWHJUOISNSAJPM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|