C18H18N2O4 — CID 51190200
3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-N-methylbenzamide (PubChem CID 51190200) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-N-methylbenzamide.
| Compound Name | 3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 51190200 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-N-methylbenzamide |
| SMILES | CC(=O)Nc1cccc(C(=O)N(C)Cc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C18H18N2O4/c1-12(21)19-15-5-3-4-14(9-15)18(22)20(2)10-13-6-7-16-17(8-13)24-11-23-16/h3-9H,10-11H2,1-2H3,(H,19,21) |
| InChIKey | LBQDAPNUCKCIEQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |