C17H17N3O4 — CID 26444164
N-(1,3-benzodioxol-5-ylmethyl)-3-(carbamoylamino)-N-methylbenzamide (PubChem CID 26444164) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-(carbamoylamino)-N-methylbenzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(carbamoylamino)-N-methylbenzamide |
|---|---|
| PubChem CID | 26444164 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(carbamoylamino)-N-methylbenzamide |
| SMILES | CN(Cc1ccc2c(c1)OCO2)C(=O)c1cccc(NC(N)=O)c1 |
| InChI | InChI=1S/C17H17N3O4/c1-20(9-11-5-6-14-15(7-11)24-10-23-14)16(21)12-3-2-4-13(8-12)19-17(18)22/h2-8H,9-10H2,1H3,(H3,18,19,22) |
| InChIKey | ANCOKMJOQCPKPH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |