C20H21NO4 — CID 125135925
N-(1,3-benzodioxol-5-ylmethyl)-N-methyl-3-[(3S)-oxolan-3-yl]benzamide (PubChem CID 125135925) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-methyl-3-[(3S)-oxolan-3-yl]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-methyl-3-[(3S)-oxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 125135925 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-methyl-3-[(3S)-oxolan-3-yl]benzamide |
| SMILES | CN(Cc1ccc2c(c1)OCO2)C(=O)c1cccc([C@@H]2CCOC2)c1 |
| InChI | InChI=1S/C20H21NO4/c1-21(11-14-5-6-18-19(9-14)25-13-24-18)20(22)16-4-2-3-15(10-16)17-7-8-23-12-17/h2-6,9-10,17H,7-8,11-13H2,1H3/t17-/m1/s1 |
| InChIKey | JWABTGCJNCSMSA-QGZVFWFLSA-N |
| XLogP | 3.19 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |