C16H13Cl2NO3 — CID 27863693
N-(1,3-benzodioxol-5-ylmethyl)-3,5-dichloro-N-methylbenzamide (PubChem CID 27863693) has the molecular formula C16H13Cl2NO3 and a molecular weight of 338.19 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3,5-dichloro-N-methylbenzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3,5-dichloro-N-methylbenzamide |
|---|---|
| PubChem CID | 27863693 |
| Molecular Formula | C16H13Cl2NO3 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3,5-dichloro-N-methylbenzamide |
| SMILES | CN(Cc1ccc2c(c1)OCO2)C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H13Cl2NO3/c1-19(16(20)11-5-12(17)7-13(18)6-11)8-10-2-3-14-15(4-10)22-9-21-14/h2-7H,8-9H2,1H3 |
| InChIKey | ZEYROSRUFDJRDO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |