C18H16N2O5 — CID 2989792
N'-(3-acetylphenyl)-N-(1,3-benzodioxol-5-ylmethyl)oxamide (PubChem CID 2989792) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is N'-(3-acetylphenyl)-N-(1,3-benzodioxol-5-ylmethyl)oxamide.
| Compound Name | N'-(3-acetylphenyl)-N-(1,3-benzodioxol-5-ylmethyl)oxamide |
|---|---|
| PubChem CID | 2989792 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N'-(3-acetylphenyl)-N-(1,3-benzodioxol-5-ylmethyl)oxamide |
| SMILES | CC(=O)c1cccc(NC(=O)C(=O)NCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C18H16N2O5/c1-11(21)13-3-2-4-14(8-13)20-18(23)17(22)19-9-12-5-6-15-16(7-12)25-10-24-15/h2-8H,9-10H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | MHIDJKFMROPOOR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|