C17H15N3O5 — CID 7584983
N-(1,3-benzodioxol-5-ylmethyl)-N'-(4-carbamoylphenyl)oxamide (PubChem CID 7584983) has the molecular formula C17H15N3O5 and a molecular weight of 341.32 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-(4-carbamoylphenyl)oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-(4-carbamoylphenyl)oxamide |
|---|---|
| PubChem CID | 7584983 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-(4-carbamoylphenyl)oxamide |
| SMILES | NC(=O)c1ccc(NC(=O)C(=O)NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H15N3O5/c18-15(21)11-2-4-12(5-3-11)20-17(23)16(22)19-8-10-1-6-13-14(7-10)25-9-24-13/h1-7H,8-9H2,(H2,18,21)(H,19,22)(H,20,23) |
| InChIKey | KVTBPSRSYMJXGD-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|