C22H18N2O4 — CID 109047465
1-N-(1,3-benzodioxol-5-ylmethyl)-4-N-phenylbenzene-1,4-dicarboxamide (PubChem CID 109047465) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is 1-N-(1,3-benzodioxol-5-ylmethyl)-4-N-phenylbenzene-1,4-dicarboxamide.
| Compound Name | 1-N-(1,3-benzodioxol-5-ylmethyl)-4-N-phenylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109047465 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 1-N-(1,3-benzodioxol-5-ylmethyl)-4-N-phenylbenzene-1,4-dicarboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1ccc(C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H18N2O4/c25-21(23-13-15-6-11-19-20(12-15)28-14-27-19)16-7-9-17(10-8-16)22(26)24-18-4-2-1-3-5-18/h1-12H,13-14H2,(H,23,25)(H,24,26) |
| InChIKey | YYVTVOMWOVEBDM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |