C21H17N3O4 — CID 109098063
2-N-(1,3-benzodioxol-5-ylmethyl)-6-N-phenylpyridine-2,6-dicarboxamide (PubChem CID 109098063) has the molecular formula C21H17N3O4 and a molecular weight of 375.38 g/mol. Its IUPAC name is 2-N-(1,3-benzodioxol-5-ylmethyl)-6-N-phenylpyridine-2,6-dicarboxamide.
| Compound Name | 2-N-(1,3-benzodioxol-5-ylmethyl)-6-N-phenylpyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109098063 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 2-N-(1,3-benzodioxol-5-ylmethyl)-6-N-phenylpyridine-2,6-dicarboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1cccc(C(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C21H17N3O4/c25-20(22-12-14-9-10-18-19(11-14)28-13-27-18)16-7-4-8-17(24-16)21(26)23-15-5-2-1-3-6-15/h1-11H,12-13H2,(H,22,25)(H,23,26) |
| InChIKey | LHHOCUQQWBLTAT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |