C18H15N3O4 — CID 3597833
2-(2-aminophenyl)-N-(1,3-benzodioxol-5-ylmethyl)-1,3-oxazole-4-carboxamide (PubChem CID 3597833) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is 2-(2-aminophenyl)-N-(1,3-benzodioxol-5-ylmethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(2-aminophenyl)-N-(1,3-benzodioxol-5-ylmethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3597833 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 2-(2-aminophenyl)-N-(1,3-benzodioxol-5-ylmethyl)-1,3-oxazole-4-carboxamide |
| SMILES | Nc1ccccc1-c1nc(C(=O)NCc2ccc3c(c2)OCO3)co1 |
| InChI | InChI=1S/C18H15N3O4/c19-13-4-2-1-3-12(13)18-21-14(9-23-18)17(22)20-8-11-5-6-15-16(7-11)25-10-24-15/h1-7,9H,8,10,19H2,(H,20,22) |
| InChIKey | XLMGJDWZLKEGID-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|