C18H14N2O4 — CID 110689223
N-(1,3-benzodioxol-5-ylmethyl)-5-phenyl-1,3-oxazole-4-carboxamide (PubChem CID 110689223) has the molecular formula C18H14N2O4 and a molecular weight of 322.32 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-5-phenyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-5-phenyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 110689223 |
| Molecular Formula | C18H14N2O4 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-5-phenyl-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1ncoc1-c1ccccc1 |
| InChI | InChI=1S/C18H14N2O4/c21-18(16-17(22-10-20-16)13-4-2-1-3-5-13)19-9-12-6-7-14-15(8-12)24-11-23-14/h1-8,10H,9,11H2,(H,19,21) |
| InChIKey | DKDGPPLVTCCTRA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |