C24H18N2O4 — CID 9452573
N-(1,3-benzodioxol-5-ylmethyl)-2-(5-phenyl-1,3-oxazol-2-yl)benzamide (PubChem CID 9452573) has the molecular formula C24H18N2O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(5-phenyl-1,3-oxazol-2-yl)benzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(5-phenyl-1,3-oxazol-2-yl)benzamide |
|---|---|
| PubChem CID | 9452573 |
| Molecular Formula | C24H18N2O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(5-phenyl-1,3-oxazol-2-yl)benzamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1ccccc1-c1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C24H18N2O4/c27-23(25-13-16-10-11-20-21(12-16)29-15-28-20)18-8-4-5-9-19(18)24-26-14-22(30-24)17-6-2-1-3-7-17/h1-12,14H,13,15H2,(H,25,27) |
| InChIKey | FZDYYYKJLKJUSM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |