C20H16N4O4 — CID 18077783
N-[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)phenyl]pyrazine-2-carboxamide (PubChem CID 18077783) has the molecular formula C20H16N4O4 and a molecular weight of 376.37 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)phenyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 18077783 |
| Molecular Formula | C20H16N4O4 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)phenyl]pyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)NCc1ccc2c(c1)OCO2)c1cnccn1 |
| InChI | InChI=1S/C20H16N4O4/c25-19(23-10-13-5-6-17-18(9-13)28-12-27-17)14-3-1-2-4-15(14)24-20(26)16-11-21-7-8-22-16/h1-9,11H,10,12H2,(H,23,25)(H,24,26) |
| InChIKey | FTUKHGBJEFUOHN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |