C25H18N2O6 — CID 71849757
N-(1,3-benzodioxol-5-ylmethyl)-2-[3-(1,3-benzodioxol-5-yl)prop-2-ynoylamino]benzamide (PubChem CID 71849757) has the molecular formula C25H18N2O6 and a molecular weight of 442.43 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[3-(1,3-benzodioxol-5-yl)prop-2-ynoylamino]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[3-(1,3-benzodioxol-5-yl)prop-2-ynoylamino]benzamide |
|---|---|
| PubChem CID | 71849757 |
| Molecular Formula | C25H18N2O6 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[3-(1,3-benzodioxol-5-yl)prop-2-ynoylamino]benzamide |
| SMILES | O=C(C#Cc1ccc2c(c1)OCO2)Nc1ccccc1C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H18N2O6/c28-24(10-7-16-5-8-20-22(11-16)32-14-30-20)27-19-4-2-1-3-18(19)25(29)26-13-17-6-9-21-23(12-17)33-15-31-21/h1-6,8-9,11-12H,13-15H2,(H,26,29)(H,27,28) |
| InChIKey | GSYLGRYAAYYJCJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|