C23H17F3N2O4 — CID 2456782
N-[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)phenyl]-2-(trifluoromethyl)benzamide (PubChem CID 2456782) has the molecular formula C23H17F3N2O4 and a molecular weight of 442.39 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)phenyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)phenyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 2456782 |
| Molecular Formula | C23H17F3N2O4 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)phenyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1ccccc1NC(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H17F3N2O4/c24-23(25,26)17-7-3-1-5-15(17)22(30)28-18-8-4-2-6-16(18)21(29)27-12-14-9-10-19-20(11-14)32-13-31-19/h1-11H,12-13H2,(H,27,29)(H,28,30) |
| InChIKey | DCSQFBYIYXRAJU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |