C17H15F3N2O3 — CID 108998849
N-(1,3-benzodioxol-5-ylmethyl)-2-[2-(trifluoromethyl)anilino]acetamide (PubChem CID 108998849) has the molecular formula C17H15F3N2O3 and a molecular weight of 352.31 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[2-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[2-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 108998849 |
| Molecular Formula | C17H15F3N2O3 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[2-(trifluoromethyl)anilino]acetamide |
| SMILES | O=C(CNc1ccccc1C(F)(F)F)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H15F3N2O3/c18-17(19,20)12-3-1-2-4-13(12)21-9-16(23)22-8-11-5-6-14-15(7-11)25-10-24-14/h1-7,21H,8-10H2,(H,22,23) |
| InChIKey | YFZQGDBOPJLHFW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |