C23H23N3O3 — CID 55897786
N-(1,3-benzodioxol-5-ylmethyl)-2-[2-(N-methylanilino)anilino]acetamide (PubChem CID 55897786) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[2-(N-methylanilino)anilino]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[2-(N-methylanilino)anilino]acetamide |
|---|---|
| PubChem CID | 55897786 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[2-(N-methylanilino)anilino]acetamide |
| SMILES | CN(c1ccccc1)c1ccccc1NCC(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H23N3O3/c1-26(18-7-3-2-4-8-18)20-10-6-5-9-19(20)24-15-23(27)25-14-17-11-12-21-22(13-17)29-16-28-21/h2-13,24H,14-16H2,1H3,(H,25,27) |
| InChIKey | XYNQFQUJBRYYEC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |