C17H15NO5 — CID 5115531
[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] benzoate (PubChem CID 5115531) has the molecular formula C17H15NO5 and a molecular weight of 313.31 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] benzoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] benzoate |
|---|---|
| PubChem CID | 5115531 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] benzoate |
| SMILES | O=C(COC(=O)c1ccccc1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H15NO5/c19-16(10-21-17(20)13-4-2-1-3-5-13)18-9-12-6-7-14-15(8-12)23-11-22-14/h1-8H,9-11H2,(H,18,19) |
| InChIKey | BVAAHIRPCBMZNF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |