C18H14N2O5 — CID 2431293
[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 4-cyanobenzoate (PubChem CID 2431293) has the molecular formula C18H14N2O5 and a molecular weight of 338.32 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 4-cyanobenzoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 2431293 |
| Molecular Formula | C18H14N2O5 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 4-cyanobenzoate |
| SMILES | N#Cc1ccc(C(=O)OCC(=O)NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H14N2O5/c19-8-12-1-4-14(5-2-12)18(22)23-10-17(21)20-9-13-3-6-15-16(7-13)25-11-24-15/h1-7H,9-11H2,(H,20,21) |
| InChIKey | PPQXJGIEDCQLCM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |