C23H19NO5 — CID 2373982
[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 4-phenylbenzoate (PubChem CID 2373982) has the molecular formula C23H19NO5 and a molecular weight of 389.41 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 4-phenylbenzoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 2373982 |
| Molecular Formula | C23H19NO5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 4-phenylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(-c2ccccc2)cc1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H19NO5/c25-22(24-13-16-6-11-20-21(12-16)29-15-28-20)14-27-23(26)19-9-7-18(8-10-19)17-4-2-1-3-5-17/h1-12H,13-15H2,(H,24,25) |
| InChIKey | VKQZZFPHTPBEOB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |