C25H23NO5 — CID 2352568
[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 3,3-diphenylpropanoate (PubChem CID 2352568) has the molecular formula C25H23NO5 and a molecular weight of 417.46 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 3,3-diphenylpropanoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 2352568 |
| Molecular Formula | C25H23NO5 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 3,3-diphenylpropanoate |
| SMILES | O=C(COC(=O)CC(c1ccccc1)c1ccccc1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H23NO5/c27-24(26-15-18-11-12-22-23(13-18)31-17-30-22)16-29-25(28)14-21(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-13,21H,14-17H2,(H,26,27) |
| InChIKey | MMPFXXKFGDUCHC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |