C22H18N2O4S — CID 8934605
N-(1,3-benzodioxol-5-ylmethyl)-2-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]benzamide (PubChem CID 8934605) has the molecular formula C22H18N2O4S and a molecular weight of 406.46 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 8934605 |
| Molecular Formula | C22H18N2O4S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]benzamide |
| SMILES | O=C(/C=C/c1cccs1)Nc1ccccc1C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H18N2O4S/c25-21(10-8-16-4-3-11-29-16)24-18-6-2-1-5-17(18)22(26)23-13-15-7-9-19-20(12-15)28-14-27-19/h1-12H,13-14H2,(H,23,26)(H,24,25)/b10-8+ |
| InChIKey | ARRWDKLGXUCYKF-CSKARUKUSA-N |
| XLogP | 4.06 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|