C16H13NO4S — CID 18076773
(E)-N-(6-acetyl-1,3-benzodioxol-5-yl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 18076773) has the molecular formula C16H13NO4S and a molecular weight of 315.35 g/mol. Its IUPAC name is (E)-N-(6-acetyl-1,3-benzodioxol-5-yl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-(6-acetyl-1,3-benzodioxol-5-yl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 18076773 |
| Molecular Formula | C16H13NO4S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | (E)-N-(6-acetyl-1,3-benzodioxol-5-yl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | CC(=O)c1cc2c(cc1NC(=O)/C=C/c1cccs1)OCO2 |
| InChI | InChI=1S/C16H13NO4S/c1-10(18)12-7-14-15(21-9-20-14)8-13(12)17-16(19)5-4-11-3-2-6-22-11/h2-8H,9H2,1H3,(H,17,19)/b5-4+ |
| InChIKey | WMRKETYSQHJWOY-SNAWJCMRSA-N |
| XLogP | 3.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|