C20H17NO6 — CID 18076880
methyl 4-[(E)-3-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-3-oxoprop-1-enyl]benzoate (PubChem CID 18076880) has the molecular formula C20H17NO6 and a molecular weight of 367.36 g/mol. Its IUPAC name is methyl 4-[(E)-3-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-3-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 18076880 |
| Molecular Formula | C20H17NO6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | methyl 4-[(E)-3-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C/C(=O)Nc2cc3c(cc2C(C)=O)OCO3)cc1 |
| InChI | InChI=1S/C20H17NO6/c1-12(22)15-9-17-18(27-11-26-17)10-16(15)21-19(23)8-5-13-3-6-14(7-4-13)20(24)25-2/h3-10H,11H2,1-2H3,(H,21,23)/b8-5+ |
| InChIKey | BMDZZFLNWFPITM-VMPITWQZSA-N |
| XLogP | 3.06 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|