C19H19NO4 — CID 3402722
methyl 4-[3-(2-methoxy-5-methylanilino)-3-oxoprop-1-enyl]benzoate (PubChem CID 3402722) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is methyl 4-[3-(2-methoxy-5-methylanilino)-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 4-[3-(2-methoxy-5-methylanilino)-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 3402722 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | methyl 4-[3-(2-methoxy-5-methylanilino)-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(C=CC(=O)Nc2cc(C)ccc2OC)cc1 |
| InChI | InChI=1S/C19H19NO4/c1-13-4-10-17(23-2)16(12-13)20-18(21)11-7-14-5-8-15(9-6-14)19(22)24-3/h4-12H,1-3H3,(H,20,21) |
| InChIKey | JRBCUUVNJWIOAV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|