C18H16FNO3 — CID 94763117
(E)-N-(5-acetyl-2-methoxyphenyl)-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 94763117) has the molecular formula C18H16FNO3 and a molecular weight of 313.33 g/mol. Its IUPAC name is (E)-N-(5-acetyl-2-methoxyphenyl)-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(5-acetyl-2-methoxyphenyl)-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 94763117 |
| Molecular Formula | C18H16FNO3 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (E)-N-(5-acetyl-2-methoxyphenyl)-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | COc1ccc(C(C)=O)cc1NC(=O)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C18H16FNO3/c1-12(21)14-6-9-17(23-2)16(11-14)20-18(22)10-5-13-3-7-15(19)8-4-13/h3-11H,1-2H3,(H,20,22)/b10-5+ |
| InChIKey | DNLBUKTUUFEWET-BJMVGYQFSA-N |
| XLogP | 3.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|