C20H21FN2O4S — CID 30393885
(E)-3-(4-fluorophenyl)-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)prop-2-enamide (PubChem CID 30393885) has the molecular formula C20H21FN2O4S and a molecular weight of 404.46 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 30393885 |
| Molecular Formula | C20H21FN2O4S |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)prop-2-enamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2)cc1NC(=O)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C20H21FN2O4S/c1-27-19-10-9-17(28(25,26)23-12-2-3-13-23)14-18(19)22-20(24)11-6-15-4-7-16(21)8-5-15/h4-11,14H,2-3,12-13H2,1H3,(H,22,24)/b11-6+ |
| InChIKey | QFYOLBUEQOVSGG-IZZDOVSWSA-N |
| XLogP | 3.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|