C23H28N2O5S — CID 42992018
(E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-(2,5-dimethoxyphenyl)prop-2-enamide (PubChem CID 42992018) has the molecular formula C23H28N2O5S and a molecular weight of 444.55 g/mol. Its IUPAC name is (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-(2,5-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-(2,5-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 42992018 |
| Molecular Formula | C23H28N2O5S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | (E)-3-[4-(azepan-1-ylsulfonyl)phenyl]-N-(2,5-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(OC)c(NC(=O)/C=C/c2ccc(S(=O)(=O)N3CCCCCC3)cc2)c1 |
| InChI | InChI=1S/C23H28N2O5S/c1-29-19-10-13-22(30-2)21(17-19)24-23(26)14-9-18-7-11-20(12-8-18)31(27,28)25-15-5-3-4-6-16-25/h7-14,17H,3-6,15-16H2,1-2H3,(H,24,26)/b14-9+ |
| InChIKey | GFTSAENIMHBAHD-NTEUORMPSA-N |
| XLogP | 3.92 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|