C20H22N2O3 — CID 110300754
4-[(E)-3-(2-methoxy-5-methylanilino)-3-oxoprop-1-enyl]-N,N-dimethylbenzamide (PubChem CID 110300754) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-[(E)-3-(2-methoxy-5-methylanilino)-3-oxoprop-1-enyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[(E)-3-(2-methoxy-5-methylanilino)-3-oxoprop-1-enyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 110300754 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 4-[(E)-3-(2-methoxy-5-methylanilino)-3-oxoprop-1-enyl]-N,N-dimethylbenzamide |
| SMILES | COc1ccc(C)cc1NC(=O)/C=C/c1ccc(C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C20H22N2O3/c1-14-5-11-18(25-4)17(13-14)21-19(23)12-8-15-6-9-16(10-7-15)20(24)22(2)3/h5-13H,1-4H3,(H,21,23)/b12-8+ |
| InChIKey | QEUHLCDRFOWXBB-XYOKQWHBSA-N |
| XLogP | 3.36 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|