C18H19N3O3 — CID 94630116
4-methoxy-N,N-dimethyl-3-[[(Z)-3-pyridin-2-ylprop-2-enoyl]amino]benzamide (PubChem CID 94630116) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 4-methoxy-N,N-dimethyl-3-[[(Z)-3-pyridin-2-ylprop-2-enoyl]amino]benzamide.
| Compound Name | 4-methoxy-N,N-dimethyl-3-[[(Z)-3-pyridin-2-ylprop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 94630116 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 4-methoxy-N,N-dimethyl-3-[[(Z)-3-pyridin-2-ylprop-2-enoyl]amino]benzamide |
| SMILES | COc1ccc(C(=O)N(C)C)cc1NC(=O)/C=C\c1ccccn1 |
| InChI | InChI=1S/C18H19N3O3/c1-21(2)18(23)13-7-9-16(24-3)15(12-13)20-17(22)10-8-14-6-4-5-11-19-14/h4-12H,1-3H3,(H,20,22)/b10-8- |
| InChIKey | SAEBPQKHSPHXJV-NTMALXAHSA-N |
| XLogP | 2.44 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|