C16H17ClN4O3 — CID 48796735
3-[(2-chloro-3-pyridinyl)carbamoylamino]-4-methoxy-N,N-dimethylbenzamide (PubChem CID 48796735) has the molecular formula C16H17ClN4O3 and a molecular weight of 348.79 g/mol. Its IUPAC name is 3-[(2-chloro-3-pyridinyl)carbamoylamino]-4-methoxy-N,N-dimethylbenzamide.
| Compound Name | 3-[(2-chloro-3-pyridinyl)carbamoylamino]-4-methoxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 48796735 |
| Molecular Formula | C16H17ClN4O3 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 3-[(2-chloro-3-pyridinyl)carbamoylamino]-4-methoxy-N,N-dimethylbenzamide |
| SMILES | COc1ccc(C(=O)N(C)C)cc1NC(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C16H17ClN4O3/c1-21(2)15(22)10-6-7-13(24-3)12(9-10)20-16(23)19-11-5-4-8-18-14(11)17/h4-9H,1-3H3,(H2,19,20,23) |
| InChIKey | QQMNCZSCSUNUNA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|